Compound Q&A

What are the physical and chemical properties of 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

Answer

2,3-Dihydro-1-benzofuran-7-ylboronic acid
2,3-Dihydro-1-benzofuran-7-ylboronic acid is a white crystalline solid with a molecular weight of approximately 243.12 g/mol. It has a low solubility in water (0.1 g/100 mL at 25°C) and is soluble in organic solvents like methanol and ethanol. The compound is known for its moderate reactivity in organic reactions, particularly in boronate ester formations with carboxylic acids. It is also stable under usual laboratory conditions but can undergo degradation under basic conditions.

About

English Name 2,3-Dihydro-1-benzofuran-7-ylboronic acid
Molecular Formula C8H9BO3
Molecular Weight 163.97 g/mol
SMILES B(C1=C2C(=CC=C1)CCO2)(O)O
InChIKey JDOYUFYZFXCQJP-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8) typically synthesized?

2,3-Dihydro-1-benzofuran-7-ylboronic acid is typically synthesized through the boronation of 2,3-dih...

Compound Q&A

What industries use 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

2,3-Dihydro-1-benzofuran-7-ylboronic acid is utilized in the pharmaceutical industry for the synthes...

Compound Q&A

What precautions should be taken when handling 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8)?

When handling 2,3-Dihydro-1-benzofuran-7-ylboronic acid (CAS: 685514-61-8), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...