Compound Q&A

What precautions should be taken when handling 3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3)?

Answer

3-(Trifluoromethyl)isonicotinic acid
When handling 3-(Trifluoromethyl)isonicotinic acid, proper personal protective equipment (PPE) should be worn, including gloves, safety goggles, and a laboratory coat. The compound should be stored in a fume hood to minimize exposure to air and to prevent unwanted reactions. Spills should be cleaned up promptly using appropriate absorbent materials, and the area should be well-ventilated. Always consult the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name 3-(Trifluoromethyl)isonicotinic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CN=CC(=C1C(=O)O)C(F)(F)F
InChIKey FBOSFEOQEZQFOC-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3)?

3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3) is a crystalline solid with a molecular weig...

Compound Q&A

How is 3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3) typically synthesized?

3-(Trifluoromethyl)isonicotinic acid is commonly synthesized by reacting 3-(trifluoromethyl)isonicot...

Compound Q&A

What industries use 3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3)?

3-(Trifluoromethyl)isonicotinic acid is used in various industries, including pharmaceuticals, where...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...