Compound Q&A

What are the physical and chemical properties of 3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3)?

Answer

3-(Trifluoromethyl)isonicotinic acid
3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3) is a crystalline solid with a molecular weight of approximately 217.08 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. This compound exhibits moderate acidity and is prone to protonation, making it susceptible to reactions with bases and nucleophiles.

About

English Name 3-(Trifluoromethyl)isonicotinic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CN=CC(=C1C(=O)O)C(F)(F)F
InChIKey FBOSFEOQEZQFOC-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3) typically synthesized?

3-(Trifluoromethyl)isonicotinic acid is commonly synthesized by reacting 3-(trifluoromethyl)isonicot...

Compound Q&A

What industries use 3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3)?

3-(Trifluoromethyl)isonicotinic acid is used in various industries, including pharmaceuticals, where...

Compound Q&A

What precautions should be taken when handling 3-(Trifluoromethyl)isonicotinic acid (CAS: 590371-38-3)?

When handling 3-(Trifluoromethyl)isonicotinic acid, proper personal protective equipment (PPE) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...