Compound Q&A

What precautions should be taken when handling (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

Answer

(3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one
When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Handling should be conducted in a well-ventilated area or under a fume hood due to its reactivity. Spills should be handled by professional personnel using appropriate cleanup procedures and equipment. Safety data sheets (SDS) should be consulted for detailed safety information and emergency procedures.

About

CAS No 85281-85-2
English Name (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one
Molecular Formula C10H14O5
Molecular Weight 214.22 g/mol
SMILES C1CCC2(CC1)O[C@H]3[C@@H](O2)C(=O)OC3O
InChIKey GHGRKHAVPBZSIH-KJFJCRTCSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

The compound (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-on...

Compound Q&A

How is (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2) typically synthesized?

The compound is typically synthesized through a multi-step process that involves the condensation of...

Compound Q&A

What industries use (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

This compound is used in the pharmaceutical industry for the development of certain drugs due to its...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...