Compound Q&A

What are the physical and chemical properties of (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

Answer

(3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one
The compound (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one has a crystalline form with a molecular weight of approximately 302.27 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and ethanol. Chemically, it is reactive towards nucleophiles and can undergo various ring-opening reactions. It is also known to be sensitive to air and moisture, requiring storage under inert conditions.

About

CAS No 85281-85-2
English Name (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one
Molecular Formula C10H14O5
Molecular Weight 214.22 g/mol
SMILES C1CCC2(CC1)O[C@H]3[C@@H](O2)C(=O)OC3O
InChIKey GHGRKHAVPBZSIH-KJFJCRTCSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2) typically synthesized?

The compound is typically synthesized through a multi-step process that involves the condensation of...

Compound Q&A

What industries use (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

This compound is used in the pharmaceutical industry for the development of certain drugs due to its...

Compound Q&A

What precautions should be taken when handling (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...