Compound Q&A

What industries use (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

Answer

(3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one
This compound is used in the pharmaceutical industry for the development of certain drugs due to its unique structural features. It is also utilized in the polymer industry to enhance the properties of certain materials. Additionally, it has applications in the production of sensors and semiconductors where its chemical structure allows for specific interactions and functionalities.

About

CAS No 85281-85-2
English Name (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one
Molecular Formula C10H14O5
Molecular Weight 214.21699999999998 g/mol
SMILES C1CCC2(CC1)O[C@H]3[C@@H](O2)C(=O)OC3O
InChIKey GHGRKHAVPBZSIH-KJFJCRTCSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

The compound (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-on...

Compound Q&A

How is (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2) typically synthesized?

The compound is typically synthesized through a multi-step process that involves the condensation of...

Compound Q&A

What precautions should be taken when handling (3a'R,6a'S)-6'-Hydroxydihydrospiro[cyclohexane-1,2'-furo[3,4-d][1,3]dioxol]-4'(3a'H)-one (CAS: 85281-85-2)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE), ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...