Compound Q&A

What industries use 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

Answer

4,7-Dibromo-3-hydroxy-2-naphthoic acid
4,7-Dibromo-3-hydroxy-2-naphthoic acid finds applications in the pharmaceutical industry for the synthesis of certain derivatives with potential medicinal value. It is also used in the polymer industry as a monomer or additive, in the semiconductor industry as a dopant, and in the sensor industry for the development of specific chemical sensors.

About

CAS No 1779-10-8
English Name 4,7-Dibromo-3-hydroxy-2-naphthoic acid
Molecular Formula C11H6Br2O3
Molecular Weight 345.974 g/mol
SMILES C1=CC2=C(C(=C(C=C2C=C1Br)C(=O)O)O)Br
InChIKey WNMKUIQCIRAXBN-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

4,7-Dibromo-3-hydroxy-2-naphthoic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8) typically synthesized?

4,7-Dibromo-3-hydroxy-2-naphthoic acid is typically synthesized via bromination of 3-hydroxy-2-napht...

Compound Q&A

What precautions should be taken when handling 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

Proper handling of 4,7-Dibromo-3-hydroxy-2-naphthoic acid requires the use of personal protective eq...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA