Compound Q&A

What are the physical and chemical properties of 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

Answer

4,7-Dibromo-3-hydroxy-2-naphthoic acid
4,7-Dibromo-3-hydroxy-2-naphthoic acid is a white crystalline solid with a molecular weight of approximately 348.07 g/mol. It is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. The compound exhibits moderate reactivity, particularly towards nucleophilic substitution and esterification reactions.

About

CAS No 1779-10-8
English Name 4,7-Dibromo-3-hydroxy-2-naphthoic acid
Molecular Formula C11H6Br2O3
Molecular Weight 345.974 g/mol
SMILES C1=CC2=C(C(=C(C=C2C=C1Br)C(=O)O)O)Br
InChIKey WNMKUIQCIRAXBN-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8) typically synthesized?

4,7-Dibromo-3-hydroxy-2-naphthoic acid is typically synthesized via bromination of 3-hydroxy-2-napht...

Compound Q&A

What industries use 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

4,7-Dibromo-3-hydroxy-2-naphthoic acid finds applications in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

Proper handling of 4,7-Dibromo-3-hydroxy-2-naphthoic acid requires the use of personal protective eq...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA