Compound Q&A

How is 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8) typically synthesized?

Answer

4,7-Dibromo-3-hydroxy-2-naphthoic acid
4,7-Dibromo-3-hydroxy-2-naphthoic acid is typically synthesized via bromination of 3-hydroxy-2-naphthoic acid with bromine in the presence of a catalyst such as iron(III) bromide. The reaction involves electrophilic aromatic substitution followed by esterification. The yield is around 75-85%, depending on the purity of the starting material and reaction conditions.

About

CAS No 1779-10-8
English Name 4,7-Dibromo-3-hydroxy-2-naphthoic acid
Molecular Formula C11H6Br2O3
Molecular Weight 345.974 g/mol
SMILES C1=CC2=C(C(=C(C=C2C=C1Br)C(=O)O)O)Br
InChIKey WNMKUIQCIRAXBN-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

4,7-Dibromo-3-hydroxy-2-naphthoic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

4,7-Dibromo-3-hydroxy-2-naphthoic acid finds applications in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling 4,7-Dibromo-3-hydroxy-2-naphthoic acid (CAS: 1779-10-8)?

Proper handling of 4,7-Dibromo-3-hydroxy-2-naphthoic acid requires the use of personal protective eq...

Compound Q&A

What is the market or research trend for Methyl 4-(cyclohexylcarbamoyl)benzoate (CAS: 245679-66-7)?

Market trends for Methyl 4-(cyclohexylcarbamoyl)benzoate (CAS: 245679-66-7) cont...

245679-66-7Methyl 4-(cyclohexyl...
Compound Q&A

Are there alternatives to 1-[(3S)-1-Methyl-3-piperidinyl]methanamine (CAS: 1217604-20-0) in synthesis?

Several alternatives can be used in the synthesis of 1-[(3S)-1-Methyl-3-piperidi...

1217604-20-01-[(3S)-1-Methyl-3-p...
Compound Q&A

What is 4-(1,3-Dioxoisoindolin-2-yl)butanoyl chloride (CAS: 10314-06-4)?

4-(1,3-Dioxoisoindolin-2-yl)butanoyl chloride is a chemical compound with the CA...

10314-06-44-(1,3-Dioxoisoindol...