Compound Q&A

What precautions should be taken when handling Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

Answer

Methyl 2,3-dihydrobenzofuran-5-carboxylate
When handling Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat to protect against skin and eye contact. Work in a well-ventilated area or fume hood to minimize inhalation exposure. Spills should be cleaned up using appropriate absorbent materials and the area thoroughly rinsed with water. Always refer to the material safety data sheet (MSDS) for detailed safety information and follow all recommended safety procedures.

About

English Name Methyl 2,3-dihydrobenzofuran-5-carboxylate
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)OCC2
InChIKey QPGLJPYOFQPEEE-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) is a white crystalline solid with a mo...

Compound Q&A

How is Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) typically synthesized?

Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) can be synthesized via the condensatio...

Compound Q&A

What industries use Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) is used in various industries, particu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...