Compound Q&A

What are the physical and chemical properties of Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

Answer

Methyl 2,3-dihydrobenzofuran-5-carboxylate
Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) is a white crystalline solid with a molecular weight of approximately 217.23 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it is less reactive than carboxylic acids but can undergo typical carboxylic acid reactions such as esterification and ester hydrolysis. It exhibits moderate acidity and can form salts with bases.

About

English Name Methyl 2,3-dihydrobenzofuran-5-carboxylate
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)OCC2
InChIKey QPGLJPYOFQPEEE-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) typically synthesized?

Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) can be synthesized via the condensatio...

Compound Q&A

What industries use Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) is used in various industries, particu...

Compound Q&A

What precautions should be taken when handling Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

When handling Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...