Compound Q&A

What industries use Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

Answer

Methyl 2,3-dihydrobenzofuran-5-carboxylate
Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) is used in various industries, particularly in the pharmaceutical and chemical sectors. It serves as a key intermediate in the synthesis of pharmaceuticals, where its chemical properties facilitate the creation of more complex molecules. It is also utilized in the production of certain polymers and as a component in sensor technology and semiconductor manufacturing, owing to its functional groups that can participate in various chemical reactions.

About

English Name Methyl 2,3-dihydrobenzofuran-5-carboxylate
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)OCC2
InChIKey QPGLJPYOFQPEEE-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) is a white crystalline solid with a mo...

Compound Q&A

How is Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) typically synthesized?

Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1) can be synthesized via the condensatio...

Compound Q&A

What precautions should be taken when handling Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1)?

When handling Methyl 2,3-dihydrobenzofuran-5-carboxylate (CAS: 588702-80-1), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...