Compound Q&A

What industries use [3-(Benzyloxy)-5-fluorophenyl]boronic acid (CAS: 850589-56-9)?

Answer

[3-(Benzyloxy)-5-fluorophenyl]boronic acid
[3-(Benzyloxy)-5-fluorophenyl]boronic acid finds applications in the pharmaceutical industry for the synthesis of drug intermediates. It is also used in the polymer industry for the modification of polymer structures and in the semiconductor industry for the production of organic semiconductors.

About

English Name [3-(Benzyloxy)-5-fluorophenyl]boronic acid
Molecular Formula C13H12BFO3
Molecular Weight 246.05 g/mol
SMILES Fc1cc(OCc2ccccc2)cc(c1)B(O)O
InChIKey QQOFKMPPQQMUDH-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Benzyloxy)-5-fluorophenyl]boronic acid (CAS: 850589-56-9)?

[3-(Benzyloxy)-5-fluorophenyl]boronic acid is a solid with a crystalline form. Its molecular weight ...

Compound Q&A

How is [3-(Benzyloxy)-5-fluorophenyl]boronic acid (CAS: 850589-56-9) typically synthesized?

[3-(Benzyloxy)-5-fluorophenyl]boronic acid is typically synthesized via a Suzuki coupling reaction. ...

Compound Q&A

What precautions should be taken when handling [3-(Benzyloxy)-5-fluorophenyl]boronic acid (CAS: 850589-56-9)?

When handling [3-(Benzyloxy)-5-fluorophenyl]boronic acid, wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...