Compound Q&A

What are the physical and chemical properties of [3-(Benzyloxy)-5-fluorophenyl]boronic acid (CAS: 850589-56-9)?

Answer

[3-(Benzyloxy)-5-fluorophenyl]boronic acid
[3-(Benzyloxy)-5-fluorophenyl]boronic acid is a solid with a crystalline form. Its molecular weight is approximately 272.24 g/mol. It has a low solubility in water but is soluble in organic solvents such as dichloromethane and dimethylformamide. It is an electrophilic reagent and shows reactivity towards nucleophiles, especially in the presence of a catalyst such as Pd(0).

About

English Name [3-(Benzyloxy)-5-fluorophenyl]boronic acid
Molecular Formula C13H12BFO3
Molecular Weight 246.05 g/mol
SMILES Fc1cc(OCc2ccccc2)cc(c1)B(O)O
InChIKey QQOFKMPPQQMUDH-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is [3-(Benzyloxy)-5-fluorophenyl]boronic acid (CAS: 850589-56-9) typically synthesized?

[3-(Benzyloxy)-5-fluorophenyl]boronic acid is typically synthesized via a Suzuki coupling reaction. ...

Compound Q&A

What industries use [3-(Benzyloxy)-5-fluorophenyl]boronic acid (CAS: 850589-56-9)?

[3-(Benzyloxy)-5-fluorophenyl]boronic acid finds applications in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling [3-(Benzyloxy)-5-fluorophenyl]boronic acid (CAS: 850589-56-9)?

When handling [3-(Benzyloxy)-5-fluorophenyl]boronic acid, wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...