Compound Q&A

What precautions should be taken when handling methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Answer

methyl 6-cyano-1H-indole-2-carboxylate
When handling methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. Work should be conducted in a well-ventilated area or a fume hood to avoid inhaling the vapors. Spills should be handled with appropriate absorbent materials, and the material safety data sheet (MSDS) should be consulted for detailed spill cleanup procedures.

About

English Name methyl 6-cyano-1H-indole-2-carboxylate
Molecular Formula C11H8N2O2
Molecular Weight 189.21 g/mol
SMILES COC(=O)C1=CC2=C(N1)C=C(C=C2)C#N
InChIKey VDOVWALYWVUEQR-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is a solid with a crystalline form. It has...

Compound Q&A

How is methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) typically synthesized?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is typically synthesized via a multistep p...

Compound Q&A

What industries use methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is primarily used in the pharmaceutical an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...