Compound Q&A

What are the physical and chemical properties of methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Answer

methyl 6-cyano-1H-indole-2-carboxylate
Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is a solid with a crystalline form. It has a molecular weight of approximately 229.21 g/mol. This compound is slightly soluble in water but soluble in common organic solvents like ethanol and dichloromethane. It is known for its reactivity towards nucleophiles and electrophiles, making it useful in various synthetic applications.

About

English Name methyl 6-cyano-1H-indole-2-carboxylate
Molecular Formula C11H8N2O2
Molecular Weight 189.21 g/mol
SMILES COC(=O)C1=CC2=C(N1)C=C(C=C2)C#N
InChIKey VDOVWALYWVUEQR-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) typically synthesized?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is typically synthesized via a multistep p...

Compound Q&A

What industries use methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is primarily used in the pharmaceutical an...

Compound Q&A

What precautions should be taken when handling methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

When handling methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0), it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...