Compound Q&A

How is methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) typically synthesized?

Answer

methyl 6-cyano-1H-indole-2-carboxylate
Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is typically synthesized via a multistep process involving the condensation of indole-2-carboxylic acid and cyanoacetamide, followed by esterification with methanol. This reaction can be catalyzed by various Lewis acids or reactive metal catalysts. The yield is typically around 70-80%.

About

English Name methyl 6-cyano-1H-indole-2-carboxylate
Molecular Formula C11H8N2O2
Molecular Weight 189.21 g/mol
SMILES COC(=O)C1=CC2=C(N1)C=C(C=C2)C#N
InChIKey VDOVWALYWVUEQR-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is a solid with a crystalline form. It has...

Compound Q&A

What industries use methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is primarily used in the pharmaceutical an...

Compound Q&A

What precautions should be taken when handling methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

When handling methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0), it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...