Compound Q&A

What industries use methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Answer

methyl 6-cyano-1H-indole-2-carboxylate
Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various medications and is also utilized in the development of new materials such as polymers and sensors due to its unique chemical functionality.

About

English Name methyl 6-cyano-1H-indole-2-carboxylate
Molecular Formula C11H8N2O2
Molecular Weight 189.21 g/mol
SMILES COC(=O)C1=CC2=C(N1)C=C(C=C2)C#N
InChIKey VDOVWALYWVUEQR-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is a solid with a crystalline form. It has...

Compound Q&A

How is methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) typically synthesized?

Methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0) is typically synthesized via a multistep p...

Compound Q&A

What precautions should be taken when handling methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0)?

When handling methyl 6-cyano-1H-indole-2-carboxylate (CAS: 104291-83-0), it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...