Compound Q&A

What industries use NBQX (CAS: 118876-58-7)?

Answer

NBQX
NBQX is primarily used in the pharmaceutical industry for its role as a selective AMPA receptor antagonist. It is also explored in sensor technology for its ability to interact with specific chemical compounds. In addition, some research applications in semiconductor development utilize NBQX. For more specific applications, refer to recent research papers and industry reports.

About

English Name NBQX
Molecular Formula C12H8N4O6S
Molecular Weight 336.28 g/mol
SMILES C1=CC2=C3C(=CC(=C2C(=C1)S(=O)(=O)N)[N+](=O)[O-])NC(=O)C(=O)N3
InChIKey UQNAFPHGVPVTAL-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of NBQX (CAS: 118876-58-7)?

NBQX is a crystalline compound with a molecular weight of approximately 255.24 g/mol. It has a melti...

Compound Q&A

How is NBQX (CAS: 118876-58-7) typically synthesized?

NBQX is usually synthesized through a multi-step process involving the condensation of 2,3-dichlorob...

Compound Q&A

What precautions should be taken when handling NBQX (CAS: 118876-58-7)?

When handling NBQX, appropriate personal protective equipment (PPE) such as gloves, goggles, and a l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...