Compound Q&A

What are the physical and chemical properties of NBQX (CAS: 118876-58-7)?

Answer

NBQX
NBQX is a crystalline compound with a molecular weight of approximately 255.24 g/mol. It has a melting point of about 165°C. NBQX is slightly soluble in water and ethanol. It is moderately reactive, showing some susceptibility to oxidation under air exposure. For detailed physicochemical properties, refer to the Material Safety Data Sheet (MSDS).

About

English Name NBQX
Molecular Formula C12H8N4O6S
Molecular Weight 336.28 g/mol
SMILES C1=CC2=C3C(=CC(=C2C(=C1)S(=O)(=O)N)[N+](=O)[O-])NC(=O)C(=O)N3
InChIKey UQNAFPHGVPVTAL-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is NBQX (CAS: 118876-58-7) typically synthesized?

NBQX is usually synthesized through a multi-step process involving the condensation of 2,3-dichlorob...

Compound Q&A

What industries use NBQX (CAS: 118876-58-7)?

NBQX is primarily used in the pharmaceutical industry for its role as a selective AMPA receptor anta...

Compound Q&A

What precautions should be taken when handling NBQX (CAS: 118876-58-7)?

When handling NBQX, appropriate personal protective equipment (PPE) such as gloves, goggles, and a l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...