Compound Q&A

How is NBQX (CAS: 118876-58-7) typically synthesized?

Answer

NBQX
NBQX is usually synthesized through a multi-step process involving the condensation of 2,3-dichlorobenzaldehyde and 4-chlorobenzylamine. The reaction is typically catalyzed by Lewis acids such as aluminum chloride and proceeds with good selectivity and moderate yield. Detailed synthesis procedures can be found in academic journals and patents.

About

English Name NBQX
Molecular Formula C12H8N4O6S
Molecular Weight 336.28 g/mol
SMILES C1=CC2=C3C(=CC(=C2C(=C1)S(=O)(=O)N)[N+](=O)[O-])NC(=O)C(=O)N3
InChIKey UQNAFPHGVPVTAL-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of NBQX (CAS: 118876-58-7)?

NBQX is a crystalline compound with a molecular weight of approximately 255.24 g/mol. It has a melti...

Compound Q&A

What industries use NBQX (CAS: 118876-58-7)?

NBQX is primarily used in the pharmaceutical industry for its role as a selective AMPA receptor anta...

Compound Q&A

What precautions should be taken when handling NBQX (CAS: 118876-58-7)?

When handling NBQX, appropriate personal protective equipment (PPE) such as gloves, goggles, and a l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...