Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

Answer

2,4-Dichloro-1-(2-nitrovinyl)benzene
When handling 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9), it is crucial to follow standard laboratory safety protocols. Use appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize exposure to vapors. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be flushed with water. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

CAS No 18984-21-9
English Name 2,4-Dichloro-1-(2-nitrovinyl)benzene
Molecular Formula C8H5Cl2NO2
Molecular Weight 218.03 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C=C[N+](=O)[O-]
InChIKey LIWIJBBAMBDXME-ONEGZZNKSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is a crystalline compound with a molecular we...

Compound Q&A

How is 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) typically synthesized?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is typically synthesized through a multi-step...

Compound Q&A

What industries use 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is used in various industries, including phar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...