Compound Q&A

How is 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) typically synthesized?

Answer

2,4-Dichloro-1-(2-nitrovinyl)benzene
2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is typically synthesized through a multi-step process involving the nitration of 2,4-dichlorobenzene followed by the vinyl chloride addition. The process often requires the use of a catalyst and involves careful control of reaction conditions to achieve high selectivity and yield. Detailed procedures are typically found in organic chemistry literature and can be adapted for laboratory-scale production.

About

CAS No 18984-21-9
English Name 2,4-Dichloro-1-(2-nitrovinyl)benzene
Molecular Formula C8H5Cl2NO2
Molecular Weight 218.03 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C=C[N+](=O)[O-]
InChIKey LIWIJBBAMBDXME-ONEGZZNKSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is a crystalline compound with a molecular we...

Compound Q&A

What industries use 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is used in various industries, including phar...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

When handling 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9), it is crucial to follow standa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...