Compound Q&A

What industries use 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

Answer

2,4-Dichloro-1-(2-nitrovinyl)benzene
2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is used in various industries, including pharmaceuticals, where it serves as a precursor for drug intermediates. It is also utilized in the synthesis of polymers and sensors due to its chemical reactivity. Additionally, it has applications in the semiconductor industry, where it can be used in the development of specific materials for electronic devices.

About

CAS No 18984-21-9
English Name 2,4-Dichloro-1-(2-nitrovinyl)benzene
Molecular Formula C8H5Cl2NO2
Molecular Weight 218.03 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C=C[N+](=O)[O-]
InChIKey LIWIJBBAMBDXME-ONEGZZNKSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is a crystalline compound with a molecular we...

Compound Q&A

How is 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) typically synthesized?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is typically synthesized through a multi-step...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

When handling 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9), it is crucial to follow standa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...