Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

Answer

2,4-Dichloro-1-(2-nitrovinyl)benzene
2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is a crystalline compound with a molecular weight of approximately 287.03 g/mol. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound is known for its reactivity towards nucleophiles and electrophiles, making it useful in various synthetic applications. It is stable under normal laboratory conditions but should be handled with care due to its chemical reactivity.

About

CAS No 18984-21-9
English Name 2,4-Dichloro-1-(2-nitrovinyl)benzene
Molecular Formula C8H5Cl2NO2
Molecular Weight 218.03 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C=C[N+](=O)[O-]
InChIKey LIWIJBBAMBDXME-ONEGZZNKSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) typically synthesized?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is typically synthesized through a multi-step...

Compound Q&A

What industries use 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9) is used in various industries, including phar...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9)?

When handling 2,4-Dichloro-1-(2-nitrovinyl)benzene (CAS: 18984-21-9), it is crucial to follow standa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...