Compound Q&A

What precautions should be taken when handling (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

Answer

(2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid
Proper personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn when handling this compound. It should be stored in a cool, dry place away from direct sunlight and sources of ignition. In case of spill, it should be handled using appropriate spill response protocols, and the Material Safety Data Sheet (MSDS) should be consulted for specific guidelines.

About

English Name (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid
Molecular Formula C24H19N3O3S
Molecular Weight 429.5 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)ON=C(C4=CSC(=N4)N)C(=O)O
InChIKey XEZIFGWTSLOMMT-MEFGMAGPSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

The compound (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid is a white crystalline sol...

Compound Q&A

How is (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7) typically synthesized?

This compound is typically synthesized by the amidation of trityloxyacetic acid with 2-amino-1,3-thi...

Compound Q&A

What industries use (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various bioactiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...