Compound Q&A

What industries use (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

Answer

(2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid
This compound is primarily used in the pharmaceutical industry for the synthesis of various bioactive molecules. It also finds applications in the polymer industry for the modification of polymers and in the semiconductor industry for the development of organic electronic devices.

About

English Name (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid
Molecular Formula C24H19N3O3S
Molecular Weight 429.5 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)ON=C(C4=CSC(=N4)N)C(=O)O
InChIKey XEZIFGWTSLOMMT-MEFGMAGPSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

The compound (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid is a white crystalline sol...

Compound Q&A

How is (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7) typically synthesized?

This compound is typically synthesized by the amidation of trityloxyacetic acid with 2-amino-1,3-thi...

Compound Q&A

What precautions should be taken when handling (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...