Compound Q&A

How is (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7) typically synthesized?

Answer

(2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid
This compound is typically synthesized by the amidation of trityloxyacetic acid with 2-amino-1,3-thiazol-4-ylamine. The reaction usually requires an appropriate catalyst and can be performed in a polar aprotic solvent. The yield is generally good, and the product can be purified by recrystallization or column chromatography.

About

English Name (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid
Molecular Formula C24H19N3O3S
Molecular Weight 429.5 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)ON=C(C4=CSC(=N4)N)C(=O)O
InChIKey XEZIFGWTSLOMMT-MEFGMAGPSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

The compound (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid is a white crystalline sol...

Compound Q&A

What industries use (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various bioactiv...

Compound Q&A

What precautions should be taken when handling (2Z)-(2-Amino-1,3-thiazol-4-yl)[(trityloxy)imino]acetic acid (CAS: 128438-01-7)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...