Compound Q&A

What industries use 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

Answer

2-Chloro-4-methoxy-1-nitrobenzene
2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is primarily used in the pharmaceutical industry for the synthesis of various intermediates and active pharmaceutical ingredients. It is also utilized in the production of dyes and pigments due to its aromatic structure. Additionally, it can be employed in the development of sensors and as a precursor in semiconductor manufacturing.

About

CAS No 28987-59-9
English Name 2-Chloro-4-methoxy-1-nitrobenzene
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES COC1=CC(=C(C=C1)[N+](=O)[O-])Cl
InChIKey QTIDRIQSPAELJC-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is a solid at room temperature with a crystallin...

Compound Q&A

How is 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) typically synthesized?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is commonly synthesized by the nitration of 2-ch...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) should be handled with caution due to its chemic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...