Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

Answer

2-Chloro-4-methoxy-1-nitrobenzene
2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is a solid at room temperature with a crystalline form. It has a molecular weight of approximately 210.04 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, especially with reducing agents and bases. It can undergo nitro reduction, chlorination, and methoxy elimination reactions under controlled conditions.

About

CAS No 28987-59-9
English Name 2-Chloro-4-methoxy-1-nitrobenzene
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES COC1=CC(=C(C=C1)[N+](=O)[O-])Cl
InChIKey QTIDRIQSPAELJC-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) typically synthesized?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is commonly synthesized by the nitration of 2-ch...

Compound Q&A

What industries use 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) should be handled with caution due to its chemic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...