Compound Q&A

How is 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) typically synthesized?

Answer

2-Chloro-4-methoxy-1-nitrobenzene
2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is commonly synthesized by the nitration of 2-chloro-4-methoxybenzene. This is typically carried out in the presence of concentrated sulfuric acid as a catalyst. The reaction is performed at low temperature to control the rate of nitration. Selectivity and yield are influenced by the reaction temperature and the concentration of the reactants.

About

CAS No 28987-59-9
English Name 2-Chloro-4-methoxy-1-nitrobenzene
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES COC1=CC(=C(C=C1)[N+](=O)[O-])Cl
InChIKey QTIDRIQSPAELJC-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is a solid at room temperature with a crystallin...

Compound Q&A

What industries use 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9)?

2-Chloro-4-methoxy-1-nitrobenzene (CAS: 28987-59-9) should be handled with caution due to its chemic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...