Compound Q&A

What precautions should be taken when handling Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Answer

Methyl 1-methyl-1H-indazole-6-carboxylate
When handling Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9), it is important to wear appropriate personal protective equipment (PPE), including gloves and safety glasses. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, it should be handled in a well-ventilated area, and the spill should be cleaned up using appropriate absorbent materials. Always refer to the safety data sheet (SDS) for specific handling and disposal instructions.

About

English Name Methyl 1-methyl-1H-indazole-6-carboxylate
Molecular Formula C10H10N2O2
Molecular Weight 190.20199999999997 g/mol
SMILES CN1C2=C(C=CC(=C2)C(=O)OC)C=N1
InChIKey RPHJVNKZUSDUDA-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is a crystalline solid with a molecula...

Compound Q&A

How is Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) typically synthesized?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is typically synthesized through the r...

Compound Q&A

What industries use Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is primarily used in the pharmaceutica...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...