Compound Q&A

What industries use Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Answer

Methyl 1-methyl-1H-indazole-6-carboxylate
Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is primarily used in the pharmaceutical and polymer industries. It serves as a building block for the synthesis of various pharmaceutical compounds and can also be employed in the development of advanced polymers. Additionally, it finds applications in the area of sensors and semiconductors due to its unique chemical properties.

About

English Name Methyl 1-methyl-1H-indazole-6-carboxylate
Molecular Formula C10H10N2O2
Molecular Weight 190.2 g/mol
SMILES CN1C2=C(C=CC(=C2)C(=O)OC)C=N1
InChIKey RPHJVNKZUSDUDA-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is a crystalline solid with a molecula...

Compound Q&A

How is Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) typically synthesized?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is typically synthesized through the r...

Compound Q&A

What precautions should be taken when handling Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

When handling Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...