Compound Q&A

What are the physical and chemical properties of Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Answer

Methyl 1-methyl-1H-indazole-6-carboxylate
Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is a crystalline solid with a molecular weight of approximately 211.25 g/mol. It has a low solubility in water but is soluble in organic solvents such as methanol and acetonitrile. This compound is chemically stable but can undergo hydrolysis under basic conditions. It reacts with nucleophiles and can be used as a functional group in organic synthesis.

About

English Name Methyl 1-methyl-1H-indazole-6-carboxylate
Molecular Formula C10H10N2O2
Molecular Weight 190.2 g/mol
SMILES CN1C2=C(C=CC(=C2)C(=O)OC)C=N1
InChIKey RPHJVNKZUSDUDA-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) typically synthesized?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is typically synthesized through the r...

Compound Q&A

What industries use Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

When handling Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...