Compound Q&A

How is Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) typically synthesized?

Answer

Methyl 1-methyl-1H-indazole-6-carboxylate
Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is typically synthesized through the reaction of methyl 1-methyl-1H-indazole-6-carboxylate with acid chlorides or anhydrides. The reaction is catalyzed by the presence of a base and usually results in high yield with good selectivity. The process is commonly performed under mild conditions, making it a suitable and efficient method for organic synthesis.

About

English Name Methyl 1-methyl-1H-indazole-6-carboxylate
Molecular Formula C10H10N2O2
Molecular Weight 190.20199999999997 g/mol
SMILES CN1C2=C(C=CC(=C2)C(=O)OC)C=N1
InChIKey RPHJVNKZUSDUDA-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is a crystalline solid with a molecula...

Compound Q&A

What industries use Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9)?

When handling Methyl 1-methyl-1H-indazole-6-carboxylate (CAS: 1007219-73-9), it is important to wear...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...