Compound Q&A

What precautions should be taken when handling (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

Answer

(3-Methoxynaphthalen-1-yl)boronic acid
When handling (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. This compound should be handled in a fume hood to minimize exposure. Spills should be immediately cleaned up using appropriate absorbent materials. In case of skin contact, wash the affected area with soap and water. For more detailed information, please refer to the safety data sheet (SDS).

About

English Name (3-Methoxynaphthalen-1-yl)boronic acid
Molecular Formula C11H11BO3
Molecular Weight 202.02 g/mol
SMILES B(C1=CC(=CC2=CC=CC=C12)OC)(O)O
InChIKey SEIWXMRNVBLGPH-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is a white crystalline solid with a molecu...

Compound Q&A

How is (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) typically synthesized?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is typically synthesized via a coupling re...

Compound Q&A

What industries use (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is primarily used in the pharmaceutical in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...