Compound Q&A

How is (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) typically synthesized?

Answer

(3-Methoxynaphthalen-1-yl)boronic acid
(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is typically synthesized via a coupling reaction between 3-methoxynaphthalene and boronic acid in the presence of a catalyst such as Pd(PPh3)4. The reaction is usually carried out in an inert solvent like toluene or DMF at a temperature around 80°C. The yield is generally high, with excellent selectivity for the desired product.

About

English Name (3-Methoxynaphthalen-1-yl)boronic acid
Molecular Formula C11H11BO3
Molecular Weight 202.02 g/mol
SMILES B(C1=CC(=CC2=CC=CC=C12)OC)(O)O
InChIKey SEIWXMRNVBLGPH-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is a white crystalline solid with a molecu...

Compound Q&A

What industries use (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

When handling (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...