Compound Q&A

What industries use (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

Answer

(3-Methoxynaphthalen-1-yl)boronic acid
(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules. It also finds applications in the production of electronic materials, specifically in the development of semiconductors and organic light-emitting diodes (OLEDs). Additionally, it is utilized in the development of sensors and polymers.

About

English Name (3-Methoxynaphthalen-1-yl)boronic acid
Molecular Formula C11H11BO3
Molecular Weight 202.02 g/mol
SMILES B(C1=CC(=CC2=CC=CC=C12)OC)(O)O
InChIKey SEIWXMRNVBLGPH-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is a white crystalline solid with a molecu...

Compound Q&A

How is (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) typically synthesized?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is typically synthesized via a coupling re...

Compound Q&A

What precautions should be taken when handling (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

When handling (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...