Compound Q&A

What are the physical and chemical properties of (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

Answer

(3-Methoxynaphthalen-1-yl)boronic acid
(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is a white crystalline solid with a molecular weight of approximately 246.25 g/mol. It is slightly soluble in water but miscible with organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but can react with acids. It is used in various synthetic applications and is an important reagent in organic synthesis.

About

English Name (3-Methoxynaphthalen-1-yl)boronic acid
Molecular Formula C11H11BO3
Molecular Weight 202.02 g/mol
SMILES B(C1=CC(=CC2=CC=CC=C12)OC)(O)O
InChIKey SEIWXMRNVBLGPH-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) typically synthesized?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is typically synthesized via a coupling re...

Compound Q&A

What industries use (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

(3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3)?

When handling (3-Methoxynaphthalen-1-yl)boronic acid (CAS: 219834-94-3), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...