Compound Q&A

What industries use Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

Answer

Ethyl 2-amino-1-benzothiophene-3-carboxylate
Ethyl 2-amino-1-benzothiophene-3-carboxylate is used in the pharmaceutical industry for the synthesis of certain drugs. It is also applied in the chemical industry for the development of sensors and in the electronics industry for the production of semiconductor materials.

About

CAS No 7311-95-7
English Name Ethyl 2-amino-1-benzothiophene-3-carboxylate
Molecular Formula C11H11NO2S
Molecular Weight 221.28 g/mol
SMILES CCOC(=O)C1=C(SC2=CC=CC=C21)N
InChIKey XNASJEQIJMDBQN-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

Ethyl 2-amino-1-benzothiophene-3-carboxylate is a solid at room temperature. It has a molecular weig...

Compound Q&A

How is Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7) typically synthesized?

Ethyl 2-amino-1-benzothiophene-3-carboxylate is typically synthesized by reacting ethyl 2-bromobenzo...

Compound Q&A

What precautions should be taken when handling Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

When handling Ethyl 2-amino-1-benzothiophene-3-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...