Compound Q&A

How is Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7) typically synthesized?

Answer

Ethyl 2-amino-1-benzothiophene-3-carboxylate
Ethyl 2-amino-1-benzothiophene-3-carboxylate is typically synthesized by reacting ethyl 2-bromobenzothiophene-3-carboxylate with ammonium hydroxide in the presence of a base like potassium carbonate. The reaction yields the target compound with good selectivity and a yield of around 70-80%.

About

CAS No 7311-95-7
English Name Ethyl 2-amino-1-benzothiophene-3-carboxylate
Molecular Formula C11H11NO2S
Molecular Weight 221.28 g/mol
SMILES CCOC(=O)C1=C(SC2=CC=CC=C21)N
InChIKey XNASJEQIJMDBQN-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

Ethyl 2-amino-1-benzothiophene-3-carboxylate is a solid at room temperature. It has a molecular weig...

Compound Q&A

What industries use Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

Ethyl 2-amino-1-benzothiophene-3-carboxylate is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

When handling Ethyl 2-amino-1-benzothiophene-3-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...