Compound Q&A

What are the physical and chemical properties of Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

Answer

Ethyl 2-amino-1-benzothiophene-3-carboxylate
Ethyl 2-amino-1-benzothiophene-3-carboxylate is a solid at room temperature. It has a molecular weight of approximately 258.34 g/mol and is slightly soluble in water. The compound is reactive towards nucleophiles and can undergo substitution reactions. It also shows good solubility in organic solvents like ethanol and acetone.

About

CAS No 7311-95-7
English Name Ethyl 2-amino-1-benzothiophene-3-carboxylate
Molecular Formula C11H11NO2S
Molecular Weight 221.28 g/mol
SMILES CCOC(=O)C1=C(SC2=CC=CC=C21)N
InChIKey XNASJEQIJMDBQN-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

How is Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7) typically synthesized?

Ethyl 2-amino-1-benzothiophene-3-carboxylate is typically synthesized by reacting ethyl 2-bromobenzo...

Compound Q&A

What industries use Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

Ethyl 2-amino-1-benzothiophene-3-carboxylate is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling Ethyl 2-amino-1-benzothiophene-3-carboxylate (CAS: 7311-95-7)?

When handling Ethyl 2-amino-1-benzothiophene-3-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...