Compound Q&A

What precautions should be taken when handling 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

Answer

4-Amino-2,3-difluoro-5-nitrobenzoic acid
When handling 4-Amino-2,3-difluoro-5-nitrobenzoic acid, it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for specific storage and disposal guidelines to ensure safety and regulatory compliance.

About

English Name 4-Amino-2,3-difluoro-5-nitrobenzoic acid
Molecular Formula C7H4F2N2O4
Molecular Weight 218.11 g/mol
SMILES C1=C(C(=C(C(=C1[N+](=O)[O-])N)F)F)C(=O)O
InChIKey WXXHOWQPFHXRDY-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

4-Amino-2,3-difluoro-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5) typically synthesized?

4-Amino-2,3-difluoro-5-nitrobenzoic acid can be synthesized through a multi-step process. Common met...

Compound Q&A

What industries use 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

4-Amino-2,3-difluoro-5-nitrobenzoic acid finds applications in pharmaceuticals, where it serves as a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...