Compound Q&A

What industries use 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

Answer

4-Amino-2,3-difluoro-5-nitrobenzoic acid
4-Amino-2,3-difluoro-5-nitrobenzoic acid finds applications in pharmaceuticals, where it serves as a precursor in the synthesis of drugs. It is also utilized in the development of sensors and as a component in the manufacturing of certain polymers. Additionally, it plays a role in semiconductor research by contributing to the development of advanced materials.

About

English Name 4-Amino-2,3-difluoro-5-nitrobenzoic acid
Molecular Formula C7H4F2N2O4
Molecular Weight 218.11 g/mol
SMILES C1=C(C(=C(C(=C1[N+](=O)[O-])N)F)F)C(=O)O
InChIKey WXXHOWQPFHXRDY-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

4-Amino-2,3-difluoro-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5) typically synthesized?

4-Amino-2,3-difluoro-5-nitrobenzoic acid can be synthesized through a multi-step process. Common met...

Compound Q&A

What precautions should be taken when handling 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

When handling 4-Amino-2,3-difluoro-5-nitrobenzoic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...