Compound Q&A

How is 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5) typically synthesized?

Answer

4-Amino-2,3-difluoro-5-nitrobenzoic acid
4-Amino-2,3-difluoro-5-nitrobenzoic acid can be synthesized through a multi-step process. Common methods include the nitration of 2,3-difluorobenzoic acid followed by reduction and alkylation. This process often involves the use of reagents like nitric acid and hydrogen fluoride, and selective reactions to ensure the correct functional groups are introduced. High yields can be achieved with careful control of conditions and appropriate catalysts.

About

English Name 4-Amino-2,3-difluoro-5-nitrobenzoic acid
Molecular Formula C7H4F2N2O4
Molecular Weight 218.11 g/mol
SMILES C1=C(C(=C(C(=C1[N+](=O)[O-])N)F)F)C(=O)O
InChIKey WXXHOWQPFHXRDY-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

4-Amino-2,3-difluoro-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

4-Amino-2,3-difluoro-5-nitrobenzoic acid finds applications in pharmaceuticals, where it serves as a...

Compound Q&A

What precautions should be taken when handling 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

When handling 4-Amino-2,3-difluoro-5-nitrobenzoic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...