Compound Q&A

What are the physical and chemical properties of 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

Answer

4-Amino-2,3-difluoro-5-nitrobenzoic acid
4-Amino-2,3-difluoro-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 238.03 g/mol. It has a melting point around 250°C and is slightly soluble in water. The compound is known for its moderate reactivity, particularly in nucleophilic aromatic substitution reactions. It also displays certain hydrophobic and acidic characteristics due to its aromatic and functional groups.

About

English Name 4-Amino-2,3-difluoro-5-nitrobenzoic acid
Molecular Formula C7H4F2N2O4
Molecular Weight 218.11 g/mol
SMILES C1=C(C(=C(C(=C1[N+](=O)[O-])N)F)F)C(=O)O
InChIKey WXXHOWQPFHXRDY-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

How is 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5) typically synthesized?

4-Amino-2,3-difluoro-5-nitrobenzoic acid can be synthesized through a multi-step process. Common met...

Compound Q&A

What industries use 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

4-Amino-2,3-difluoro-5-nitrobenzoic acid finds applications in pharmaceuticals, where it serves as a...

Compound Q&A

What precautions should be taken when handling 4-Amino-2,3-difluoro-5-nitrobenzoic acid (CAS: 284030-57-5)?

When handling 4-Amino-2,3-difluoro-5-nitrobenzoic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...