Compound Q&A

What precautions should be taken when handling Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Answer

(Dichloromethylene)bis(phosphonic acid)
When handling Dichloromethylenebis(phosphonic acid), it is essential to wear appropriate personal protective equipment (PPE), such as gloves, safety goggles, and a laboratory coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbents, and the area should be well-ventilated. Detailed safety data sheets (SDS) should be consulted for specific handling guidelines and emergency procedures.

About

CAS No 10596-23-3
English Name (Dichloromethylene)bis(phosphonic acid)
Molecular Formula CH4Cl2O6P2
Molecular Weight 244.89 g/mol
SMILES C(P(=O)(O)O)(P(=O)(O)O)(Cl)Cl
InChIKey ACSIXWWBWUQEHA-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Dichloromethylenebis(phosphonic acid) is a colorless or slightly yellow crystalline solid with a mol...

Compound Q&A

How is Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3) typically synthesized?

Dichloromethylenebis(phosphonic acid) is often synthesized through a multi-step process involving th...

Compound Q&A

What industries use Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Dichloromethylenebis(phosphonic acid) is primarily used in the pharmaceutical industry for the synth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...