Compound Q&A

What industries use Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Answer

(Dichloromethylene)bis(phosphonic acid)
Dichloromethylenebis(phosphonic acid) is primarily used in the pharmaceutical industry for the synthesis of certain drugs, and in the polymer industry for the modification of polymers to enhance their properties. It also finds applications in the semiconductor industry for etching processes and in sensors for specific chemical detection.

About

CAS No 10596-23-3
English Name (Dichloromethylene)bis(phosphonic acid)
Molecular Formula CH4Cl2O6P2
Molecular Weight 244.89 g/mol
SMILES C(P(=O)(O)O)(P(=O)(O)O)(Cl)Cl
InChIKey ACSIXWWBWUQEHA-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Dichloromethylenebis(phosphonic acid) is a colorless or slightly yellow crystalline solid with a mol...

Compound Q&A

How is Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3) typically synthesized?

Dichloromethylenebis(phosphonic acid) is often synthesized through a multi-step process involving th...

Compound Q&A

What precautions should be taken when handling Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

When handling Dichloromethylenebis(phosphonic acid), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...