Compound Q&A

How is Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3) typically synthesized?

Answer

(Dichloromethylene)bis(phosphonic acid)
Dichloromethylenebis(phosphonic acid) is often synthesized through a multi-step process involving the reaction of chloromethylphosphonic acid with chlorine gas. The synthesis typically involves the use of a solvent and requires careful control of reaction conditions to achieve high yield and selectivity. The process is usually conducted in an inert atmosphere to prevent side reactions.

About

CAS No 10596-23-3
English Name (Dichloromethylene)bis(phosphonic acid)
Molecular Formula CH4Cl2O6P2
Molecular Weight 244.89 g/mol
SMILES C(P(=O)(O)O)(P(=O)(O)O)(Cl)Cl
InChIKey ACSIXWWBWUQEHA-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Dichloromethylenebis(phosphonic acid) is a colorless or slightly yellow crystalline solid with a mol...

Compound Q&A

What industries use Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Dichloromethylenebis(phosphonic acid) is primarily used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

When handling Dichloromethylenebis(phosphonic acid), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...