Compound Q&A

What are the physical and chemical properties of Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Answer

(Dichloromethylene)bis(phosphonic acid)
Dichloromethylenebis(phosphonic acid) is a colorless or slightly yellow crystalline solid with a molecular weight of approximately 196.97 g/mol. It has a high solubility in water and limited solubility in organic solvents. The compound is reactive towards bases and can undergo hydrolysis. It is stable under normal conditions but should be stored in a dry, cool environment to prevent degradation.

About

CAS No 10596-23-3
English Name (Dichloromethylene)bis(phosphonic acid)
Molecular Formula CH4Cl2O6P2
Molecular Weight 244.89 g/mol
SMILES C(P(=O)(O)O)(P(=O)(O)O)(Cl)Cl
InChIKey ACSIXWWBWUQEHA-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3) typically synthesized?

Dichloromethylenebis(phosphonic acid) is often synthesized through a multi-step process involving th...

Compound Q&A

What industries use Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

Dichloromethylenebis(phosphonic acid) is primarily used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling Dichloromethylenebis(phosphonic acid) (CAS: 10596-23-3)?

When handling Dichloromethylenebis(phosphonic acid), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...